C22H31NO10 — CID 174462644
4-hexoxy-2-hydroxy-3-(4-hydroxyphenoxy)-2-(2-morpholin-4-yloxy-2-oxoethyl)-4-oxobutanoic acid (PubChem CID 174462644) has the molecular formula C22H31NO10 and a molecular weight of 469.49 g/mol. Its IUPAC name is 4-hexoxy-2-hydroxy-3-(4-hydroxyphenoxy)-2-(2-morpholin-4-yloxy-2-oxoethyl)-4-oxobutanoic acid.
| Compound Name | 4-hexoxy-2-hydroxy-3-(4-hydroxyphenoxy)-2-(2-morpholin-4-yloxy-2-oxoethyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174462644 |
| Molecular Formula | C22H31NO10 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 4-hexoxy-2-hydroxy-3-(4-hydroxyphenoxy)-2-(2-morpholin-4-yloxy-2-oxoethyl)-4-oxobutanoic acid |
| SMILES | CCCCCCOC(=O)C(Oc1ccc(O)cc1)C(O)(CC(=O)ON1CCOCC1)C(=O)O |
| InChI | InChI=1S/C22H31NO10/c1-2-3-4-5-12-31-20(26)19(32-17-8-6-16(24)7-9-17)22(29,21(27)28)15-18(25)33-23-10-13-30-14-11-23/h6-9,19,24,29H,2-5,10-15H2,1H3,(H,27,28) |
| InChIKey | CLLKZOYBBVDRHC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|