C9H14OS4 — CID 174462747
4-sulfanyl-5-[2-(sulfanylmethyl)-1,3-dithiolan-4-yl]pent-1-en-3-one (PubChem CID 174462747) has the molecular formula C9H14OS4 and a molecular weight of 266.48 g/mol. Its IUPAC name is 4-sulfanyl-5-[2-(sulfanylmethyl)-1,3-dithiolan-4-yl]pent-1-en-3-one.
| Compound Name | 4-sulfanyl-5-[2-(sulfanylmethyl)-1,3-dithiolan-4-yl]pent-1-en-3-one |
|---|---|
| PubChem CID | 174462747 |
| Molecular Formula | C9H14OS4 |
| Molecular Weight | 266.48 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 4-sulfanyl-5-[2-(sulfanylmethyl)-1,3-dithiolan-4-yl]pent-1-en-3-one |
| SMILES | C=CC(=O)C(S)CC1CSC(CS)S1 |
| InChI | InChI=1S/C9H14OS4/c1-2-7(10)8(12)3-6-5-13-9(4-11)14-6/h2,6,8-9,11-12H,1,3-5H2 |
| InChIKey | YNWWOBCHTNFCTR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|