C9H14O4S4 — CID 175238959
3-methyl-2-oxo-1-[2-(sulfanylmethyl)-1,3-dithiolan-4-yl]but-3-ene-1-sulfonic acid (PubChem CID 175238959) has the molecular formula C9H14O4S4 and a molecular weight of 314.48 g/mol. Its IUPAC name is 3-methyl-2-oxo-1-[2-(sulfanylmethyl)-1,3-dithiolan-4-yl]but-3-ene-1-sulfonic acid.
| Compound Name | 3-methyl-2-oxo-1-[2-(sulfanylmethyl)-1,3-dithiolan-4-yl]but-3-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 175238959 |
| Molecular Formula | C9H14O4S4 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 3-methyl-2-oxo-1-[2-(sulfanylmethyl)-1,3-dithiolan-4-yl]but-3-ene-1-sulfonic acid |
| SMILES | C=C(C)C(=O)C(C1CSC(CS)S1)S(=O)(=O)O |
| InChI | InChI=1S/C9H14O4S4/c1-5(2)8(10)9(17(11,12)13)6-4-15-7(3-14)16-6/h6-7,9,14H,1,3-4H2,2H3,(H,11,12,13) |
| InChIKey | ZUKSNBFVQULSLF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|