C15H18BrNO4 — CID 174463115
5-(1-bromoethyl)isoindole-1,3-dione;tert-butyl formate (PubChem CID 174463115) has the molecular formula C15H18BrNO4 and a molecular weight of 356.22 g/mol. Its IUPAC name is 5-(1-bromoethyl)isoindole-1,3-dione;tert-butyl formate.
| Compound Name | 5-(1-bromoethyl)isoindole-1,3-dione;tert-butyl formate |
|---|---|
| PubChem CID | 174463115 |
| Molecular Formula | C15H18BrNO4 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 5-(1-bromoethyl)isoindole-1,3-dione;tert-butyl formate |
| SMILES | CC(Br)c1ccc2c(c1)C(=O)NC2=O.CC(C)(C)OC=O |
| InChI | InChI=1S/C10H8BrNO2.C5H10O2/c1-5(11)6-2-3-7-8(4-6)10(14)12-9(7)13;1-5(2,3)7-4-6/h2-5H,1H3,(H,12,13,14);4H,1-3H3 |
| InChIKey | MGFANKUWVNYZEB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|