C15H20FN3O6 — CID 174463258
[1-(2-fluoro-4-nitroanilino)-4-hydroxy-1-oxobutan-2-yl] N-tert-butylcarbamate (PubChem CID 174463258) has the molecular formula C15H20FN3O6 and a molecular weight of 357.34 g/mol. Its IUPAC name is [1-(2-fluoro-4-nitroanilino)-4-hydroxy-1-oxobutan-2-yl] N-tert-butylcarbamate.
| Compound Name | [1-(2-fluoro-4-nitroanilino)-4-hydroxy-1-oxobutan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174463258 |
| Molecular Formula | C15H20FN3O6 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | [1-(2-fluoro-4-nitroanilino)-4-hydroxy-1-oxobutan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC(CCO)C(=O)Nc1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C15H20FN3O6/c1-15(2,3)18-14(22)25-12(6-7-20)13(21)17-11-5-4-9(19(23)24)8-10(11)16/h4-5,8,12,20H,6-7H2,1-3H3,(H,17,21)(H,18,22) |
| InChIKey | JDQZNZIWENVEDL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|