C12H7ClN2O6 — CID 174463803
2-chloro-4-(3,5-dinitrophenyl)benzene-1,3-diol (PubChem CID 174463803) has the molecular formula C12H7ClN2O6 and a molecular weight of 310.65 g/mol. Its IUPAC name is 2-chloro-4-(3,5-dinitrophenyl)benzene-1,3-diol.
| Compound Name | 2-chloro-4-(3,5-dinitrophenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 174463803 |
| Molecular Formula | C12H7ClN2O6 |
| Molecular Weight | 310.65 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 2-chloro-4-(3,5-dinitrophenyl)benzene-1,3-diol |
| SMILES | O=[N+]([O-])c1cc(-c2ccc(O)c(Cl)c2O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H7ClN2O6/c13-11-10(16)2-1-9(12(11)17)6-3-7(14(18)19)5-8(4-6)15(20)21/h1-5,16-17H |
| InChIKey | FJKAJBREUZXSNJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.65 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|