About butylcyclohexane;tert-butyl formate;thiophen-2-amine
butylcyclohexane;tert-butyl formate;thiophen-2-amine (PubChem CID 174464728) has the molecular formula C19H35NO2S
and a molecular weight of 341.56 g/mol. Its IUPAC name is butylcyclohexane;tert-butyl formate;thiophen-2-amine.
Molecular Properties
| Compound Name | butylcyclohexane;tert-butyl formate;thiophen-2-amine |
| PubChem CID | 174464728 |
| Molecular Formula | C19H35NO2S |
| Molecular Weight | 341.56 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | butylcyclohexane;tert-butyl formate;thiophen-2-amine |
| SMILES | CC(C)(C)OC=O.CCCCC1CCCCC1.Nc1cccs1 |
| InChI | InChI=1S/C10H20.C5H10O2.C4H5NS/c1-2-3-7-10-8-5-4-6-9-10;1-5(2,3)7-4-6;5-4-2-1-3-6-4/h10H,2-9H2,1H3;4H,1-3H3;1-3H,5H2 |
| InChIKey | UMSKBGOEMRJNOU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze butylcyclohexane;tert-butyl formate;thiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylcyclohexane;tert-butyl formate;thiophen-2-amine?
The IUPAC name of butylcyclohexane;tert-butyl formate;thiophen-2-amine (CID 174464728) is butylcyclohexane;tert-butyl formate;thiophen-2-amine.
What is the SMILES notation for butylcyclohexane;tert-butyl formate;thiophen-2-amine?
The canonical SMILES for butylcyclohexane;tert-butyl formate;thiophen-2-amine is CC(C)(C)OC=O.CCCCC1CCCCC1.Nc1cccs1.
What is the InChIKey of butylcyclohexane;tert-butyl formate;thiophen-2-amine?
The InChIKey is UMSKBGOEMRJNOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.C5H10O2.C4H5NS/c1-2-3-7-10-8-5-4-6-9-10;1-5(2,3)7-4-6;5-4-2-1-3-6-4/h10H,2-9H2,1H3;4H,1-3H3;1-3H,5H2.
What are the key properties of butylcyclohexane;tert-butyl formate;thiophen-2-amine?
butylcyclohexane;tert-butyl formate;thiophen-2-amine has a molecular weight of 341.56 g/mol, XLogP of 6.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butylcyclohexane;tert-butyl formate;thiophen-2-amine is sourced from PubChem (CID 174464728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).