About fluoro 4-(3-chloropropoxy)-3-ethylbenzoate
fluoro 4-(3-chloropropoxy)-3-ethylbenzoate (PubChem CID 174466899) has the molecular formula C12H14ClFO3
and a molecular weight of 260.69 g/mol. Its IUPAC name is fluoro 4-(3-chloropropoxy)-3-ethylbenzoate.
Molecular Properties
| Compound Name | fluoro 4-(3-chloropropoxy)-3-ethylbenzoate |
| PubChem CID | 174466899 |
| Molecular Formula | C12H14ClFO3 |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | fluoro 4-(3-chloropropoxy)-3-ethylbenzoate |
| SMILES | CCc1cc(C(=O)OF)ccc1OCCCCl |
| InChI | InChI=1S/C12H14ClFO3/c1-2-9-8-10(12(15)17-14)4-5-11(9)16-7-3-6-13/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | YCVVIROWQNAPBO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze fluoro 4-(3-chloropropoxy)-3-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 4-(3-chloropropoxy)-3-ethylbenzoate?
The IUPAC name of fluoro 4-(3-chloropropoxy)-3-ethylbenzoate (CID 174466899) is fluoro 4-(3-chloropropoxy)-3-ethylbenzoate.
What is the SMILES notation for fluoro 4-(3-chloropropoxy)-3-ethylbenzoate?
The canonical SMILES for fluoro 4-(3-chloropropoxy)-3-ethylbenzoate is CCc1cc(C(=O)OF)ccc1OCCCCl.
What is the InChIKey of fluoro 4-(3-chloropropoxy)-3-ethylbenzoate?
The InChIKey is YCVVIROWQNAPBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClFO3/c1-2-9-8-10(12(15)17-14)4-5-11(9)16-7-3-6-13/h4-5,8H,2-3,6-7H2,1H3.
What are the key properties of fluoro 4-(3-chloropropoxy)-3-ethylbenzoate?
fluoro 4-(3-chloropropoxy)-3-ethylbenzoate has a molecular weight of 260.69 g/mol, XLogP of 3.30, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 4-(3-chloropropoxy)-3-ethylbenzoate is sourced from PubChem (CID 174466899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).