C15H17FO4 — CID 143955564
fluoro 4-[(2E,4Z)-2-ethylhexa-2,4-dienoxy]-3-hydroxybenzoate (PubChem CID 143955564) has the molecular formula C15H17FO4 and a molecular weight of 280.30 g/mol. Its IUPAC name is fluoro 4-[(2E,4Z)-2-ethylhexa-2,4-dienoxy]-3-hydroxybenzoate.
| Compound Name | fluoro 4-[(2E,4Z)-2-ethylhexa-2,4-dienoxy]-3-hydroxybenzoate |
|---|---|
| PubChem CID | 143955564 |
| Molecular Formula | C15H17FO4 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | fluoro 4-[(2E,4Z)-2-ethylhexa-2,4-dienoxy]-3-hydroxybenzoate |
| SMILES | C/C=C\C=C(/CC)COc1ccc(C(=O)OF)cc1O |
| InChI | InChI=1S/C15H17FO4/c1-3-5-6-11(4-2)10-19-14-8-7-12(9-13(14)17)15(18)20-16/h3,5-9,17H,4,10H2,1-2H3/b5-3-,11-6+ |
| InChIKey | SLZPOTDFKXRHGN-GGKXIICKSA-N |
| XLogP | 3.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|