C19H16Cl2F2N2O — CID 174470890
2,4-bis[4-(aminomethyl)-3-fluorophenyl]-1,5-dichloropenta-1,4-dien-3-one (PubChem CID 174470890) has the molecular formula C19H16Cl2F2N2O and a molecular weight of 397.25 g/mol. Its IUPAC name is 2,4-bis[4-(aminomethyl)-3-fluorophenyl]-1,5-dichloropenta-1,4-dien-3-one.
| Compound Name | 2,4-bis[4-(aminomethyl)-3-fluorophenyl]-1,5-dichloropenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 174470890 |
| Molecular Formula | C19H16Cl2F2N2O |
| Molecular Weight | 397.25 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2,4-bis[4-(aminomethyl)-3-fluorophenyl]-1,5-dichloropenta-1,4-dien-3-one |
| SMILES | NCc1ccc(C(=CCl)C(=O)C(=CCl)c2ccc(CN)c(F)c2)cc1F |
| InChI | InChI=1S/C19H16Cl2F2N2O/c20-7-15(11-1-3-13(9-24)17(22)5-11)19(26)16(8-21)12-2-4-14(10-25)18(23)6-12/h1-8H,9-10,24-25H2 |
| InChIKey | AYEHPKWJXMLIJM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.25 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|