C21H20FN3O2 — CID 174472871
2-(4-benzyl-4-fluoropiperidin-1-yl)-N-(3-cyanophenyl)-2-oxoacetamide (PubChem CID 174472871) has the molecular formula C21H20FN3O2 and a molecular weight of 365.41 g/mol. Its IUPAC name is 2-(4-benzyl-4-fluoropiperidin-1-yl)-N-(3-cyanophenyl)-2-oxoacetamide.
| Compound Name | 2-(4-benzyl-4-fluoropiperidin-1-yl)-N-(3-cyanophenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 174472871 |
| Molecular Formula | C21H20FN3O2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-(4-benzyl-4-fluoropiperidin-1-yl)-N-(3-cyanophenyl)-2-oxoacetamide |
| SMILES | N#Cc1cccc(NC(=O)C(=O)N2CCC(F)(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H20FN3O2/c22-21(14-16-5-2-1-3-6-16)9-11-25(12-10-21)20(27)19(26)24-18-8-4-7-17(13-18)15-23/h1-8,13H,9-12,14H2,(H,24,26) |
| InChIKey | OBIDIRMXQRCWCC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|