C15H15NO — CID 174472978
N-(3,3-diphenylpropylidene)hydroxylamine (PubChem CID 174472978) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(3,3-diphenylpropylidene)hydroxylamine.
| Compound Name | N-(3,3-diphenylpropylidene)hydroxylamine |
|---|---|
| PubChem CID | 174472978 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N-(3,3-diphenylpropylidene)hydroxylamine |
| SMILES | ON=CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15NO/c17-16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,12,15,17H,11H2 |
| InChIKey | OCWKGXQLEOHMJY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|