C16H17P — CID 154147270
4,4-diphenylbut-1-enylphosphane (PubChem CID 154147270) has the molecular formula C16H17P and a molecular weight of 240.29 g/mol. Its IUPAC name is 4,4-diphenylbut-1-enylphosphane.
| Compound Name | 4,4-diphenylbut-1-enylphosphane |
|---|---|
| PubChem CID | 154147270 |
| Molecular Formula | C16H17P |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4,4-diphenylbut-1-enylphosphane |
| SMILES | PC=CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17P/c17-13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-11,13,16H,12,17H2 |
| InChIKey | NDBHAFLBOZVJDK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|