C19H22N6O2 — CID 174473246
[4-[4-amino-7-(dimethylamino)quinazolin-2-yl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 174473246) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is [4-[4-amino-7-(dimethylamino)quinazolin-2-yl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[4-amino-7-(dimethylamino)quinazolin-2-yl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 174473246 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [4-[4-amino-7-(dimethylamino)quinazolin-2-yl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | CN(C)c1ccc2c(N)nc(N3CCN(C(=O)c4ccco4)CC3)nc2c1 |
| InChI | InChI=1S/C19H22N6O2/c1-23(2)13-5-6-14-15(12-13)21-19(22-17(14)20)25-9-7-24(8-10-25)18(26)16-4-3-11-27-16/h3-6,11-12H,7-10H2,1-2H3,(H2,20,21,22) |
| InChIKey | PTMBPXKXEMRBMZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |