C18H19N5O4 — CID 171713803
[4-(4-amino-6-hydroxy-7-methoxyquinazolin-2-yl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 171713803) has the molecular formula C18H19N5O4 and a molecular weight of 377.43 g/mol. Its IUPAC name is [4-(4-amino-6-hydroxy-7-methoxyquinazolin-2-yl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-(4-amino-6-hydroxy-7-methoxyquinazolin-2-yl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 171713803 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [4-(4-amino-6-hydroxy-7-methoxyquinazolin-2-yl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | [2H]C1([2H])N(C(=O)c2ccco2)C([2H])([2H])C([2H])([2H])N(c2nc(N)c3cc(O)c(OC)cc3n2)C1([2H])[2H] |
| InChI | InChI=1S/C18H19N5O4/c1-26-15-10-12-11(9-13(15)24)16(19)21-18(20-12)23-6-4-22(5-7-23)17(25)14-3-2-8-27-14/h2-3,8-10,24H,4-7H2,1H3,(H2,19,20,21)/i4D2,5D2,6D2,7D2 |
| InChIKey | MEIJXVLQSXTSIJ-DUSUNJSHSA-N |
| XLogP | 1.48 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |