C19H20F2O — CID 174476086
5-butyl-5,6-difluoro-1-methoxy-2-(2-phenylethynyl)cyclohexa-1,3-diene (PubChem CID 174476086) has the molecular formula C19H20F2O and a molecular weight of 302.36 g/mol. Its IUPAC name is 5-butyl-5,6-difluoro-1-methoxy-2-(2-phenylethynyl)cyclohexa-1,3-diene.
| Compound Name | 5-butyl-5,6-difluoro-1-methoxy-2-(2-phenylethynyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 174476086 |
| Molecular Formula | C19H20F2O |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-butyl-5,6-difluoro-1-methoxy-2-(2-phenylethynyl)cyclohexa-1,3-diene |
| SMILES | CCCCC1(F)C=CC(C#Cc2ccccc2)=C(OC)C1F |
| InChI | InChI=1S/C19H20F2O/c1-3-4-13-19(21)14-12-16(17(22-2)18(19)20)11-10-15-8-6-5-7-9-15/h5-9,12,14,18H,3-4,13H2,1-2H3 |
| InChIKey | PBBWJPYDQJUCQD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|