C11H13ClN2O4S — CID 174478335
5-chloro-1H-indole-2-sulfonic acid;N,N-dimethylformamide (PubChem CID 174478335) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.76 g/mol. Its IUPAC name is 5-chloro-1H-indole-2-sulfonic acid;N,N-dimethylformamide.
| Compound Name | 5-chloro-1H-indole-2-sulfonic acid;N,N-dimethylformamide |
|---|---|
| PubChem CID | 174478335 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 5-chloro-1H-indole-2-sulfonic acid;N,N-dimethylformamide |
| SMILES | CN(C)C=O.O=S(=O)(O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C8H6ClNO3S.C3H7NO/c9-6-1-2-7-5(3-6)4-8(10-7)14(11,12)13;1-4(2)3-5/h1-4,10H,(H,11,12,13);3H,1-2H3 |
| InChIKey | LUHDPZWOOIJIQI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|