C18H20FNO2 — CID 174478810
1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,7-dihydroisoquinoline (PubChem CID 174478810) has the molecular formula C18H20FNO2 and a molecular weight of 301.36 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,7-dihydroisoquinoline.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,7-dihydroisoquinoline |
|---|---|
| PubChem CID | 174478810 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethoxy-3,7-dihydroisoquinoline |
| SMILES | CON1CC=C2C=CCC=C2C1(Cc1ccc(F)cc1)OC |
| InChI | InChI=1S/C18H20FNO2/c1-21-18(13-14-7-9-16(19)10-8-14)17-6-4-3-5-15(17)11-12-20(18)22-2/h3,5-11H,4,12-13H2,1-2H3 |
| InChIKey | DVKOVJNBPQTGBN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |