C10H13Cl2N3O5S — CID 174480906
1-(4-chloro-2-nitrophenyl)sulfonylpiperazin-2-ol;hydrochloride (PubChem CID 174480906) has the molecular formula C10H13Cl2N3O5S and a molecular weight of 358.20 g/mol. Its IUPAC name is 1-(4-chloro-2-nitrophenyl)sulfonylpiperazin-2-ol;hydrochloride.
| Compound Name | 1-(4-chloro-2-nitrophenyl)sulfonylpiperazin-2-ol;hydrochloride |
|---|---|
| PubChem CID | 174480906 |
| Molecular Formula | C10H13Cl2N3O5S |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 1-(4-chloro-2-nitrophenyl)sulfonylpiperazin-2-ol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc(Cl)ccc1S(=O)(=O)N1CCNCC1O |
| InChI | InChI=1S/C10H12ClN3O5S.ClH/c11-7-1-2-9(8(5-7)14(16)17)20(18,19)13-4-3-12-6-10(13)15;/h1-2,5,10,12,15H,3-4,6H2;1H |
| InChIKey | AYMMZFSHRWHAHB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|