C14H15BrClNO3 — CID 174483377
2-bromoethyl 5-chloro-2-[(cyclopropanecarbonylamino)methyl]benzoate (PubChem CID 174483377) has the molecular formula C14H15BrClNO3 and a molecular weight of 360.64 g/mol. Its IUPAC name is 2-bromoethyl 5-chloro-2-[(cyclopropanecarbonylamino)methyl]benzoate.
| Compound Name | 2-bromoethyl 5-chloro-2-[(cyclopropanecarbonylamino)methyl]benzoate |
|---|---|
| PubChem CID | 174483377 |
| Molecular Formula | C14H15BrClNO3 |
| Molecular Weight | 360.64 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 2-bromoethyl 5-chloro-2-[(cyclopropanecarbonylamino)methyl]benzoate |
| SMILES | O=C(OCCBr)c1cc(Cl)ccc1CNC(=O)C1CC1 |
| InChI | InChI=1S/C14H15BrClNO3/c15-5-6-20-14(19)12-7-11(16)4-3-10(12)8-17-13(18)9-1-2-9/h3-4,7,9H,1-2,5-6,8H2,(H,17,18) |
| InChIKey | WQHORPQJGWPCNC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.64 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|