C28H42O2 — CID 174483837
2-[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-2-phenoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-1-ol (PubChem CID 174483837) has the molecular formula C28H42O2 and a molecular weight of 410.64 g/mol. Its IUPAC name is 2-[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-2-phenoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-1-ol.
| Compound Name | 2-[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-2-phenoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-1-ol |
|---|---|
| PubChem CID | 174483837 |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | 2-[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-2-phenoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-1-ol |
| SMILES | CC(CO)[C@H]1CC[C@H]2[C@@H]3CCC4CCC(Oc5ccccc5)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H42O2/c1-19(18-29)24-13-14-25-23-12-10-20-9-11-22(30-21-7-5-4-6-8-21)17-28(20,3)26(23)15-16-27(24,25)2/h4-8,19-20,22-26,29H,9-18H2,1-3H3/t19?,20?,22?,23-,24+,25-,26-,27+,28-/m0/s1 |
| InChIKey | ZDGXQGHIBMHORK-MPTZZQPQSA-N |
| XLogP | 6.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |