C29H40O3 — CID 174571339
[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-(1-oxopropan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl] benzoate (PubChem CID 174571339) has the molecular formula C29H40O3 and a molecular weight of 436.64 g/mol. Its IUPAC name is [(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-(1-oxopropan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl] benzoate.
| Compound Name | [(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-(1-oxopropan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl] benzoate |
|---|---|
| PubChem CID | 174571339 |
| Molecular Formula | C29H40O3 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | [(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-(1-oxopropan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl] benzoate |
| SMILES | CC(C=O)[C@H]1CC[C@H]2[C@@H]3CCC4CCC(OC(=O)c5ccccc5)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H40O3/c1-19(18-30)24-13-14-25-23-12-10-21-9-11-22(32-27(31)20-7-5-4-6-8-20)17-29(21,3)26(23)15-16-28(24,25)2/h4-8,18-19,21-26H,9-17H2,1-3H3/t19?,21?,22?,23-,24+,25-,26-,28+,29-/m0/s1 |
| InChIKey | WUVLMINYAKORAN-BZDJMLDBSA-N |
| XLogP | 6.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|