C10H17IO4 — CID 174484688
4-iodo-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid (PubChem CID 174484688) has the molecular formula C10H17IO4 and a molecular weight of 328.15 g/mol. Its IUPAC name is 4-iodo-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid.
| Compound Name | 4-iodo-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid |
|---|---|
| PubChem CID | 174484688 |
| Molecular Formula | C10H17IO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 4-iodo-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)C(C)(CCI)C(=O)O |
| InChI | InChI=1S/C10H17IO4/c1-9(2,3)15-8(14)10(4,5-6-11)7(12)13/h5-6H2,1-4H3,(H,12,13) |
| InChIKey | GYIXUNGOFCZEML-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|