About 4-butoxybenzamide;ethyl carbonochloridate
4-butoxybenzamide;ethyl carbonochloridate (PubChem CID 174486229) has the molecular formula C14H20ClNO4
and a molecular weight of 301.77 g/mol. Its IUPAC name is 4-butoxybenzamide;ethyl carbonochloridate.
Molecular Properties
| Compound Name | 4-butoxybenzamide;ethyl carbonochloridate |
| PubChem CID | 174486229 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4-butoxybenzamide;ethyl carbonochloridate |
| SMILES | CCCCOc1ccc(C(N)=O)cc1.CCOC(=O)Cl |
| InChI | InChI=1S/C11H15NO2.C3H5ClO2/c1-2-3-8-14-10-6-4-9(5-7-10)11(12)13;1-2-6-3(4)5/h4-7H,2-3,8H2,1H3,(H2,12,13);2H2,1H3 |
| InChIKey | FXZUVYKEIWHGJO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxybenzamide;ethyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxybenzamide;ethyl carbonochloridate?
The IUPAC name of 4-butoxybenzamide;ethyl carbonochloridate (CID 174486229) is 4-butoxybenzamide;ethyl carbonochloridate.
What is the SMILES notation for 4-butoxybenzamide;ethyl carbonochloridate?
The canonical SMILES for 4-butoxybenzamide;ethyl carbonochloridate is CCCCOc1ccc(C(N)=O)cc1.CCOC(=O)Cl.
What is the InChIKey of 4-butoxybenzamide;ethyl carbonochloridate?
The InChIKey is FXZUVYKEIWHGJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.C3H5ClO2/c1-2-3-8-14-10-6-4-9(5-7-10)11(12)13;1-2-6-3(4)5/h4-7H,2-3,8H2,1H3,(H2,12,13);2H2,1H3.
What are the key properties of 4-butoxybenzamide;ethyl carbonochloridate?
4-butoxybenzamide;ethyl carbonochloridate has a molecular weight of 301.77 g/mol, XLogP of 3.35, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxybenzamide;ethyl carbonochloridate is sourced from PubChem (CID 174486229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).