About 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate
1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate (PubChem CID 174487732) has the molecular formula C18H25NO4
and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate.
Molecular Properties
| Compound Name | 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate |
| PubChem CID | 174487732 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate |
| SMILES | CC1(CC(C)(C(=O)ON)C(=O)OCc2ccccc2)CCCC1 |
| InChI | InChI=1S/C18H25NO4/c1-17(10-6-7-11-17)13-18(2,16(21)23-19)15(20)22-12-14-8-4-3-5-9-14/h3-5,8-9H,6-7,10-13,19H2,1-2H3 |
| InChIKey | PNTNFIMBLQWQBJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate?
The IUPAC name of 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate (CID 174487732) is 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate.
What is the SMILES notation for 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate?
The canonical SMILES for 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate is CC1(CC(C)(C(=O)ON)C(=O)OCc2ccccc2)CCCC1.
What is the InChIKey of 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate?
The InChIKey is PNTNFIMBLQWQBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO4/c1-17(10-6-7-11-17)13-18(2,16(21)23-19)15(20)22-12-14-8-4-3-5-9-14/h3-5,8-9H,6-7,10-13,19H2,1-2H3.
What are the key properties of 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate?
1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate has a molecular weight of 319.40 g/mol, XLogP of 3.12, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-amino 3-O-benzyl 2-methyl-2-[(1-methylcyclopentyl)methyl]propanedioate is sourced from PubChem (CID 174487732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).