C17H20ClFN4O5S2 — CID 174488614
N'-[5-chloro-4-(methanesulfonamidomethyl)-1,3-thiazol-2-yl]-N'-[4-fluoro-2-(2-methylpropoxy)phenyl]oxamide (PubChem CID 174488614) has the molecular formula C17H20ClFN4O5S2 and a molecular weight of 478.96 g/mol. Its IUPAC name is N'-[5-chloro-4-(methanesulfonamidomethyl)-1,3-thiazol-2-yl]-N'-[4-fluoro-2-(2-methylpropoxy)phenyl]oxamide.
| Compound Name | N'-[5-chloro-4-(methanesulfonamidomethyl)-1,3-thiazol-2-yl]-N'-[4-fluoro-2-(2-methylpropoxy)phenyl]oxamide |
|---|---|
| PubChem CID | 174488614 |
| Molecular Formula | C17H20ClFN4O5S2 |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | N'-[5-chloro-4-(methanesulfonamidomethyl)-1,3-thiazol-2-yl]-N'-[4-fluoro-2-(2-methylpropoxy)phenyl]oxamide |
| SMILES | CC(C)COc1cc(F)ccc1N(C(=O)C(N)=O)c1nc(CNS(C)(=O)=O)c(Cl)s1 |
| InChI | InChI=1S/C17H20ClFN4O5S2/c1-9(2)8-28-13-6-10(19)4-5-12(13)23(16(25)15(20)24)17-22-11(14(18)29-17)7-21-30(3,26)27/h4-6,9,21H,7-8H2,1-3H3,(H2,20,24) |
| InChIKey | GHZVGXVDAVPCFZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 131.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|