C21H26BrN5O2S — CID 174488794
2-(3-bromophenyl)-N-[4-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]cyclohexyl]-2-sulfinylacetamide (PubChem CID 174488794) has the molecular formula C21H26BrN5O2S and a molecular weight of 492.44 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-[4-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]cyclohexyl]-2-sulfinylacetamide.
| Compound Name | 2-(3-bromophenyl)-N-[4-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]cyclohexyl]-2-sulfinylacetamide |
|---|---|
| PubChem CID | 174488794 |
| Molecular Formula | C21H26BrN5O2S |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 2-(3-bromophenyl)-N-[4-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]cyclohexyl]-2-sulfinylacetamide |
| SMILES | Cc1cnc(NC2CCC(NC(=O)C(=S=O)c3cccc(Br)c3)CC2)nc1N(C)C |
| InChI | InChI=1S/C21H26BrN5O2S/c1-13-12-23-21(26-19(13)27(2)3)25-17-9-7-16(8-10-17)24-20(28)18(30-29)14-5-4-6-15(22)11-14/h4-6,11-12,16-17H,7-10H2,1-3H3,(H,24,28)(H,23,25,26) |
| InChIKey | MKQOBMWYDHTLHL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|