About 1H-benzimidazol-2-yl dihydrogen phosphate
1H-benzimidazol-2-yl dihydrogen phosphate (PubChem CID 174491341) has the molecular formula C7H7N2O4P
and a molecular weight of 214.12 g/mol. Its IUPAC name is 1H-benzimidazol-2-yl dihydrogen phosphate.
Molecular Properties
| Compound Name | 1H-benzimidazol-2-yl dihydrogen phosphate |
| PubChem CID | 174491341 |
| Molecular Formula | C7H7N2O4P |
| Molecular Weight | 214.12 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 1H-benzimidazol-2-yl dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C7H7N2O4P/c10-14(11,12)13-7-8-5-3-1-2-4-6(5)9-7/h1-4H,(H,8,9)(H2,10,11,12) |
| InChIKey | MOJMESHDMUXDGW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.12 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazol-2-yl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-2-yl dihydrogen phosphate?
The IUPAC name of 1H-benzimidazol-2-yl dihydrogen phosphate (CID 174491341) is 1H-benzimidazol-2-yl dihydrogen phosphate.
What is the SMILES notation for 1H-benzimidazol-2-yl dihydrogen phosphate?
The canonical SMILES for 1H-benzimidazol-2-yl dihydrogen phosphate is O=P(O)(O)Oc1nc2ccccc2[nH]1.
What is the InChIKey of 1H-benzimidazol-2-yl dihydrogen phosphate?
The InChIKey is MOJMESHDMUXDGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2O4P/c10-14(11,12)13-7-8-5-3-1-2-4-6(5)9-7/h1-4H,(H,8,9)(H2,10,11,12).
What are the key properties of 1H-benzimidazol-2-yl dihydrogen phosphate?
1H-benzimidazol-2-yl dihydrogen phosphate has a molecular weight of 214.12 g/mol, XLogP of 1.03, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-2-yl dihydrogen phosphate is sourced from PubChem (CID 174491341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).