C17H22O7 — CID 174492039
3-hydroxypropanoic acid;1,4,5,8-tetramethoxynaphthalene (PubChem CID 174492039) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is 3-hydroxypropanoic acid;1,4,5,8-tetramethoxynaphthalene.
| Compound Name | 3-hydroxypropanoic acid;1,4,5,8-tetramethoxynaphthalene |
|---|---|
| PubChem CID | 174492039 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-hydroxypropanoic acid;1,4,5,8-tetramethoxynaphthalene |
| SMILES | COc1ccc(OC)c2c(OC)ccc(OC)c12.O=C(O)CCO |
| InChI | InChI=1S/C14H16O4.C3H6O3/c1-15-9-5-6-11(17-3)14-12(18-4)8-7-10(16-2)13(9)14;4-2-1-3(5)6/h5-8H,1-4H3;4H,1-2H2,(H,5,6) |
| InChIKey | XULHKGPJDGYZTF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |