About 1,1'-biphenyl;1-ethynyl-9H-carbazole
1,1'-biphenyl;1-ethynyl-9H-carbazole (PubChem CID 174492389) has the molecular formula C26H19N
and a molecular weight of 345.44 g/mol. Its IUPAC name is 1,1'-biphenyl;1-ethynyl-9H-carbazole.
Molecular Properties
| Compound Name | 1,1'-biphenyl;1-ethynyl-9H-carbazole |
| PubChem CID | 174492389 |
| Molecular Formula | C26H19N |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1,1'-biphenyl;1-ethynyl-9H-carbazole |
| SMILES | C#Cc1cccc2c1[nH]c1ccccc12.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H9N.C12H10/c1-2-10-6-5-8-12-11-7-3-4-9-13(11)15-14(10)12;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1,3-9,15H;1-10H |
| InChIKey | RSTZUUQIVMXCPJ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;1-ethynyl-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;1-ethynyl-9H-carbazole?
The IUPAC name of 1,1'-biphenyl;1-ethynyl-9H-carbazole (CID 174492389) is 1,1'-biphenyl;1-ethynyl-9H-carbazole.
What is the SMILES notation for 1,1'-biphenyl;1-ethynyl-9H-carbazole?
The canonical SMILES for 1,1'-biphenyl;1-ethynyl-9H-carbazole is C#Cc1cccc2c1[nH]c1ccccc12.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;1-ethynyl-9H-carbazole?
The InChIKey is RSTZUUQIVMXCPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N.C12H10/c1-2-10-6-5-8-12-11-7-3-4-9-13(11)15-14(10)12;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1,3-9,15H;1-10H.
What are the key properties of 1,1'-biphenyl;1-ethynyl-9H-carbazole?
1,1'-biphenyl;1-ethynyl-9H-carbazole has a molecular weight of 345.44 g/mol, XLogP of 6.66, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;1-ethynyl-9H-carbazole is sourced from PubChem (CID 174492389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).