C16H9N — CID 54113864
1-buta-1,3-diynyl-9H-carbazole (PubChem CID 54113864) has the molecular formula C16H9N and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-buta-1,3-diynyl-9H-carbazole.
| Compound Name | 1-buta-1,3-diynyl-9H-carbazole |
|---|---|
| PubChem CID | 54113864 |
| Molecular Formula | C16H9N |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-buta-1,3-diynyl-9H-carbazole |
| SMILES | C#CC#Cc1cccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C16H9N/c1-2-3-7-12-8-6-10-14-13-9-4-5-11-15(13)17-16(12)14/h1,4-6,8-11,17H |
| InChIKey | NIYRYQZWFLVZET-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|