C19H27NO3 — CID 174493039
6,8-dimethyl-2-octoxy-4H-3,1-benzoxazine-4-carbaldehyde (PubChem CID 174493039) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 6,8-dimethyl-2-octoxy-4H-3,1-benzoxazine-4-carbaldehyde.
| Compound Name | 6,8-dimethyl-2-octoxy-4H-3,1-benzoxazine-4-carbaldehyde |
|---|---|
| PubChem CID | 174493039 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 6,8-dimethyl-2-octoxy-4H-3,1-benzoxazine-4-carbaldehyde |
| SMILES | CCCCCCCCOC1=Nc2c(C)cc(C)cc2C(C=O)O1 |
| InChI | InChI=1S/C19H27NO3/c1-4-5-6-7-8-9-10-22-19-20-18-15(3)11-14(2)12-16(18)17(13-21)23-19/h11-13,17H,4-10H2,1-3H3 |
| InChIKey | QVPGSIWARJPARY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|