C9H23N3O7S2 — CID 174493599
methanesulfonic acid;4-methoxyimino-N-methylpiperidin-3-amine (PubChem CID 174493599) has the molecular formula C9H23N3O7S2 and a molecular weight of 349.43 g/mol. Its IUPAC name is methanesulfonic acid;4-methoxyimino-N-methylpiperidin-3-amine.
| Compound Name | methanesulfonic acid;4-methoxyimino-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 174493599 |
| Molecular Formula | C9H23N3O7S2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | methanesulfonic acid;4-methoxyimino-N-methylpiperidin-3-amine |
| SMILES | CNC1CNCCC1=NOC.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C7H15N3O.2CH4O3S/c1-8-7-5-9-4-3-6(7)10-11-2;2*1-5(2,3)4/h7-9H,3-5H2,1-2H3;2*1H3,(H,2,3,4) |
| InChIKey | BFKZMKXURBABKF-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 154.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|