C10H20N4O3 — CID 141356278
(2S,3R)-2-amino-3-hydroxy-N-(4-methoxyiminopiperidin-3-yl)butanamide (PubChem CID 141356278) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxy-N-(4-methoxyiminopiperidin-3-yl)butanamide.
| Compound Name | (2S,3R)-2-amino-3-hydroxy-N-(4-methoxyiminopiperidin-3-yl)butanamide |
|---|---|
| PubChem CID | 141356278 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxy-N-(4-methoxyiminopiperidin-3-yl)butanamide |
| SMILES | CON=C1CCNCC1NC(=O)[C@@H](N)[C@@H](C)O |
| InChI | InChI=1S/C10H20N4O3/c1-6(15)9(11)10(16)13-8-5-12-4-3-7(8)14-17-2/h6,8-9,12,15H,3-5,11H2,1-2H3,(H,13,16)/t6-,8?,9+/m1/s1 |
| InChIKey | UVLWSZHUWHFVCJ-MSSDQNSGSA-N |
| XLogP | -1.83 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|