C26H25N5OS — CID 174495259
1-[3-(aminomethyl)phenyl]-1-[4-(4-amino-7-pent-1-ynylthieno[3,2-c]pyridin-3-yl)phenyl]urea (PubChem CID 174495259) has the molecular formula C26H25N5OS and a molecular weight of 455.59 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]-1-[4-(4-amino-7-pent-1-ynylthieno[3,2-c]pyridin-3-yl)phenyl]urea.
| Compound Name | 1-[3-(aminomethyl)phenyl]-1-[4-(4-amino-7-pent-1-ynylthieno[3,2-c]pyridin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 174495259 |
| Molecular Formula | C26H25N5OS |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]-1-[4-(4-amino-7-pent-1-ynylthieno[3,2-c]pyridin-3-yl)phenyl]urea |
| SMILES | CCCC#Cc1cnc(N)c2c(-c3ccc(N(C(N)=O)c4cccc(CN)c4)cc3)csc12 |
| InChI | InChI=1S/C26H25N5OS/c1-2-3-4-7-19-15-30-25(28)23-22(16-33-24(19)23)18-9-11-20(12-10-18)31(26(29)32)21-8-5-6-17(13-21)14-27/h5-6,8-13,15-16H,2-3,14,27H2,1H3,(H2,28,30)(H2,29,32) |
| InChIKey | KRAWMFFZSJYXDV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|