C20H19N3OS — CID 141322452
7-(3-morpholin-4-ylprop-1-ynyl)-3-phenylthieno[3,2-c]pyridin-4-amine (PubChem CID 141322452) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is 7-(3-morpholin-4-ylprop-1-ynyl)-3-phenylthieno[3,2-c]pyridin-4-amine.
| Compound Name | 7-(3-morpholin-4-ylprop-1-ynyl)-3-phenylthieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 141322452 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 7-(3-morpholin-4-ylprop-1-ynyl)-3-phenylthieno[3,2-c]pyridin-4-amine |
| SMILES | Nc1ncc(C#CCN2CCOCC2)c2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H19N3OS/c21-20-18-17(15-5-2-1-3-6-15)14-25-19(18)16(13-22-20)7-4-8-23-9-11-24-12-10-23/h1-3,5-6,13-14H,8-12H2,(H2,21,22) |
| InChIKey | KKYJNYPFDPMKQH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|