C20H21N3S — CID 174681399
3-(4-aminophenyl)-7-(3-ethylpent-1-ynyl)thieno[3,2-c]pyridin-4-amine (PubChem CID 174681399) has the molecular formula C20H21N3S and a molecular weight of 335.48 g/mol. Its IUPAC name is 3-(4-aminophenyl)-7-(3-ethylpent-1-ynyl)thieno[3,2-c]pyridin-4-amine.
| Compound Name | 3-(4-aminophenyl)-7-(3-ethylpent-1-ynyl)thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 174681399 |
| Molecular Formula | C20H21N3S |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-(4-aminophenyl)-7-(3-ethylpent-1-ynyl)thieno[3,2-c]pyridin-4-amine |
| SMILES | CCC(C#Cc1cnc(N)c2c(-c3ccc(N)cc3)csc12)CC |
| InChI | InChI=1S/C20H21N3S/c1-3-13(4-2)5-6-15-11-23-20(22)18-17(12-24-19(15)18)14-7-9-16(21)10-8-14/h7-13H,3-4,21H2,1-2H3,(H2,22,23) |
| InChIKey | QTLMODXJMJESFN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|