C20H17N4O2S2- — CID 141110430
4-amino-3-(4-aminophenyl)-7-[4-[(sulfinatoamino)methyl]phenyl]thieno[3,2-c]pyridine (PubChem CID 141110430) has the molecular formula C20H17N4O2S2- and a molecular weight of 409.52 g/mol. Its IUPAC name is 4-amino-3-(4-aminophenyl)-7-[4-[(sulfinatoamino)methyl]phenyl]thieno[3,2-c]pyridine.
| Compound Name | 4-amino-3-(4-aminophenyl)-7-[4-[(sulfinatoamino)methyl]phenyl]thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 141110430 |
| Molecular Formula | C20H17N4O2S2- |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 4-amino-3-(4-aminophenyl)-7-[4-[(sulfinatoamino)methyl]phenyl]thieno[3,2-c]pyridine |
| SMILES | Nc1ccc(-c2csc3c(-c4ccc(CNS(=O)[O-])cc4)cnc(N)c23)cc1 |
| InChI | InChI=1S/C20H18N4O2S2/c21-15-7-5-14(6-8-15)17-11-27-19-16(10-23-20(22)18(17)19)13-3-1-12(2-4-13)9-24-28(25)26/h1-8,10-11,24H,9,21H2,(H2,22,23)(H,25,26)/p-1 |
| InChIKey | VGRMHTLXMTUBSI-UHFFFAOYSA-M |
| XLogP | 3.68 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|