C23H18N3O2S2- — CID 174509712
[4-[4-amino-3-(2-methyl-1H-indol-5-yl)thieno[3,2-c]pyridin-7-yl]phenyl]methanesulfinate (PubChem CID 174509712) has the molecular formula C23H18N3O2S2- and a molecular weight of 432.55 g/mol. Its IUPAC name is [4-[4-amino-3-(2-methyl-1H-indol-5-yl)thieno[3,2-c]pyridin-7-yl]phenyl]methanesulfinate.
| Compound Name | [4-[4-amino-3-(2-methyl-1H-indol-5-yl)thieno[3,2-c]pyridin-7-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174509712 |
| Molecular Formula | C23H18N3O2S2- |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | [4-[4-amino-3-(2-methyl-1H-indol-5-yl)thieno[3,2-c]pyridin-7-yl]phenyl]methanesulfinate |
| SMILES | Cc1cc2cc(-c3csc4c(-c5ccc(CS(=O)[O-])cc5)cnc(N)c34)ccc2[nH]1 |
| InChI | InChI=1S/C23H19N3O2S2/c1-13-8-17-9-16(6-7-20(17)26-13)19-11-29-22-18(10-25-23(24)21(19)22)15-4-2-14(3-5-15)12-30(27)28/h2-11,26H,12H2,1H3,(H2,24,25)(H,27,28)/p-1 |
| InChIKey | IVDLTULLMALNOI-UHFFFAOYSA-M |
| XLogP | 5.38 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|