C20H15N3O2S — CID 18450714
3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine (PubChem CID 18450714) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine.
| Compound Name | 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 18450714 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine |
| SMILES | Nc1ccc(-c2csc3c(-c4ccc5c(c4)OCO5)cnc(N)c23)cc1 |
| InChI | InChI=1S/C20H15N3O2S/c21-13-4-1-11(2-5-13)15-9-26-19-14(8-23-20(22)18(15)19)12-3-6-16-17(7-12)25-10-24-16/h1-9H,10,21H2,(H2,22,23) |
| InChIKey | BGJLIIDDVRPLKJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|