About 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine
3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine (PubChem CID 18450714) has the molecular formula C20H15N3O2S
and a molecular weight of 361.43 g/mol. Its IUPAC name is 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine |
| PubChem CID | 18450714 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine |
| SMILES | Nc1ccc(-c2csc3c(-c4ccc5c(c4)OCO5)cnc(N)c23)cc1 |
| InChI | InChI=1S/C20H15N3O2S/c21-13-4-1-11(2-5-13)15-9-26-19-14(8-23-20(22)18(15)19)12-3-6-16-17(7-12)25-10-24-16/h1-9H,10,21H2,(H2,22,23) |
| InChIKey | BGJLIIDDVRPLKJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine?
The IUPAC name of 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine (CID 18450714) is 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine.
What is the SMILES notation for 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine?
The canonical SMILES for 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine is Nc1ccc(-c2csc3c(-c4ccc5c(c4)OCO5)cnc(N)c23)cc1.
What is the InChIKey of 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine?
The InChIKey is BGJLIIDDVRPLKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O2S/c21-13-4-1-11(2-5-13)15-9-26-19-14(8-23-20(22)18(15)19)12-3-6-16-17(7-12)25-10-24-16/h1-9H,10,21H2,(H2,22,23).
What are the key properties of 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine?
3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine has a molecular weight of 361.43 g/mol, XLogP of 4.52, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminophenyl)-7-(1,3-benzodioxol-5-yl)thieno[3,2-c]pyridin-4-amine is sourced from PubChem (CID 18450714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).