C22H20N4O2S2 — CID 174693975
4-amino-3-(2,3-dihydro-1H-indol-5-yl)-7-[4-[(sulfinoamino)methyl]phenyl]thieno[3,2-c]pyridine (PubChem CID 174693975) has the molecular formula C22H20N4O2S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-amino-3-(2,3-dihydro-1H-indol-5-yl)-7-[4-[(sulfinoamino)methyl]phenyl]thieno[3,2-c]pyridine.
| Compound Name | 4-amino-3-(2,3-dihydro-1H-indol-5-yl)-7-[4-[(sulfinoamino)methyl]phenyl]thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 174693975 |
| Molecular Formula | C22H20N4O2S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 4-amino-3-(2,3-dihydro-1H-indol-5-yl)-7-[4-[(sulfinoamino)methyl]phenyl]thieno[3,2-c]pyridine |
| SMILES | Nc1ncc(-c2ccc(CNS(=O)O)cc2)c2scc(-c3ccc4c(c3)CCN4)c12 |
| InChI | InChI=1S/C22H20N4O2S2/c23-22-20-18(15-5-6-19-16(9-15)7-8-24-19)12-29-21(20)17(11-25-22)14-3-1-13(2-4-14)10-26-30(27)28/h1-6,9,11-12,24,26H,7-8,10H2,(H2,23,25)(H,27,28) |
| InChIKey | PYNSNRWRCTZEOP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|