About CID 167497685
CID 167497685 (PubChem CID 167497685) has the molecular formula C27H18B5N5OS
and a molecular weight of 514.60 g/mol.
Molecular Properties
| Compound Name | CID 167497685 |
| PubChem CID | 167497685 |
| Molecular Formula | C27H18B5N5OS |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(CC(=O)N2CCc3cc(-c4csc5c(-c6cnn(C)c6)cnc(N)c45)ccc32)c([B])c1[B] |
| InChI | InChI=1S/C27H18B5N5OS/c1-36-10-14(8-35-36)16-9-34-27(33)20-17(11-39-26(16)20)12-2-3-18-13(6-12)4-5-37(18)19(38)7-15-21(28)23(30)25(32)24(31)22(15)29/h2-3,6,8-11H,4-5,7H2,1H3,(H2,33,34) |
| InChIKey | JJSCTJGKZVBXRW-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167497685 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167497685?
The IUPAC name of CID 167497685 (CID 167497685) is not available.
What is the SMILES notation for CID 167497685?
The canonical SMILES for CID 167497685 is [B]c1c([B])c([B])c(CC(=O)N2CCc3cc(-c4csc5c(-c6cnn(C)c6)cnc(N)c45)ccc32)c([B])c1[B].
What is the InChIKey of CID 167497685?
The InChIKey is JJSCTJGKZVBXRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18B5N5OS/c1-36-10-14(8-35-36)16-9-34-27(33)20-17(11-39-26(16)20)12-2-3-18-13(6-12)4-5-37(18)19(38)7-15-21(28)23(30)25(32)24(31)22(15)29/h2-3,6,8-11H,4-5,7H2,1H3,(H2,33,34).
What are the key properties of CID 167497685?
CID 167497685 has a molecular weight of 514.60 g/mol, XLogP of -0.95, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167497685 is sourced from PubChem (CID 167497685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).