C27H18B5N5OS — CID 167497685
CID 167497685 (PubChem CID 167497685) has the molecular formula C27H18B5N5OS and a molecular weight of 514.60 g/mol.
| Compound Name | CID 167497685 |
|---|---|
| PubChem CID | 167497685 |
| Molecular Formula | C27H18B5N5OS |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(CC(=O)N2CCc3cc(-c4csc5c(-c6cnn(C)c6)cnc(N)c45)ccc32)c([B])c1[B] |
| InChI | InChI=1S/C27H18B5N5OS/c1-36-10-14(8-35-36)16-9-34-27(33)20-17(11-39-26(16)20)12-2-3-18-13(6-12)4-5-37(18)19(38)7-15-21(28)23(30)25(32)24(31)22(15)29/h2-3,6,8-11H,4-5,7H2,1H3,(H2,33,34) |
| InChIKey | JJSCTJGKZVBXRW-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|