C29H35F3N4O3 — CID 174495422
N-[2-[[(2R)-4-[4-[4-(dimethylcarbamoyl)phenyl]cyclohexyl]-4-iminobutan-2-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 174495422) has the molecular formula C29H35F3N4O3 and a molecular weight of 544.62 g/mol. Its IUPAC name is N-[2-[[(2R)-4-[4-[4-(dimethylcarbamoyl)phenyl]cyclohexyl]-4-iminobutan-2-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[(2R)-4-[4-[4-(dimethylcarbamoyl)phenyl]cyclohexyl]-4-iminobutan-2-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174495422 |
| Molecular Formula | C29H35F3N4O3 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | N-[2-[[(2R)-4-[4-[4-(dimethylcarbamoyl)phenyl]cyclohexyl]-4-iminobutan-2-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | [H]/N=C(/C[C@@H](C)NC(=O)CNC(=O)c1cccc(C(F)(F)F)c1)C1CCC(c2ccc(C(=O)N(C)C)cc2)CC1 |
| InChI | InChI=1S/C29H35F3N4O3/c1-18(35-26(37)17-34-27(38)23-5-4-6-24(16-23)29(30,31)32)15-25(33)21-11-7-19(8-12-21)20-9-13-22(14-10-20)28(39)36(2)3/h4-6,9-10,13-14,16,18-19,21,33H,7-8,11-12,15,17H2,1-3H3,(H,34,38)(H,35,37)/b33-25-/t18-,19?,21?/m1/s1 |
| InChIKey | YJHHPQVBVULWMQ-GCUVZOLKSA-N |
| XLogP | 5.03 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|