C21H21ClN4O2 — CID 174496807
1-(3-chloroisoquinolin-5-yl)-1-[(4-morpholin-4-ylphenyl)methyl]urea (PubChem CID 174496807) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 1-(3-chloroisoquinolin-5-yl)-1-[(4-morpholin-4-ylphenyl)methyl]urea.
| Compound Name | 1-(3-chloroisoquinolin-5-yl)-1-[(4-morpholin-4-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 174496807 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-(3-chloroisoquinolin-5-yl)-1-[(4-morpholin-4-ylphenyl)methyl]urea |
| SMILES | NC(=O)N(Cc1ccc(N2CCOCC2)cc1)c1cccc2cnc(Cl)cc12 |
| InChI | InChI=1S/C21H21ClN4O2/c22-20-12-18-16(13-24-20)2-1-3-19(18)26(21(23)27)14-15-4-6-17(7-5-15)25-8-10-28-11-9-25/h1-7,12-13H,8-11,14H2,(H2,23,27) |
| InChIKey | FQQHQSNSABDAGA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|