C23H26F3N3O3S — CID 174497010
(3-amino-2-cyclobutyl-5-methylsulfonylphenyl)-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 174497010) has the molecular formula C23H26F3N3O3S and a molecular weight of 481.54 g/mol. Its IUPAC name is (3-amino-2-cyclobutyl-5-methylsulfonylphenyl)-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (3-amino-2-cyclobutyl-5-methylsulfonylphenyl)-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 174497010 |
| Molecular Formula | C23H26F3N3O3S |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (3-amino-2-cyclobutyl-5-methylsulfonylphenyl)-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | CS(=O)(=O)c1cc(N)c(C2CCC2)c(C(=O)N2CCN(c3ccc(C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C23H26F3N3O3S/c1-33(31,32)18-13-19(21(20(27)14-18)15-3-2-4-15)22(30)29-11-9-28(10-12-29)17-7-5-16(6-8-17)23(24,25)26/h5-8,13-15H,2-4,9-12,27H2,1H3 |
| InChIKey | DXJCOMSVERBPFD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|