C23H24F3N3O4 — CID 69039574
(2-cyclopentyloxy-5-nitrophenyl)-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 69039574) has the molecular formula C23H24F3N3O4 and a molecular weight of 463.46 g/mol. Its IUPAC name is (2-cyclopentyloxy-5-nitrophenyl)-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (2-cyclopentyloxy-5-nitrophenyl)-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 69039574 |
| Molecular Formula | C23H24F3N3O4 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (2-cyclopentyloxy-5-nitrophenyl)-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1OC1CCCC1)N1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H24F3N3O4/c24-23(25,26)16-5-7-17(8-6-16)27-11-13-28(14-12-27)22(30)20-15-18(29(31)32)9-10-21(20)33-19-3-1-2-4-19/h5-10,15,19H,1-4,11-14H2 |
| InChIKey | HCMUUBJPVBQQHH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|