C21H22F3N3O5 — CID 87768619
[2-(3-hydroxypropoxy)-5-nitrophenyl]-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 87768619) has the molecular formula C21H22F3N3O5 and a molecular weight of 453.42 g/mol. Its IUPAC name is [2-(3-hydroxypropoxy)-5-nitrophenyl]-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | [2-(3-hydroxypropoxy)-5-nitrophenyl]-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 87768619 |
| Molecular Formula | C21H22F3N3O5 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | [2-(3-hydroxypropoxy)-5-nitrophenyl]-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1OCCCO)N1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H22F3N3O5/c22-21(23,24)15-2-4-16(5-3-15)25-8-10-26(11-9-25)20(29)18-14-17(27(30)31)6-7-19(18)32-13-1-12-28/h2-7,14,28H,1,8-13H2 |
| InChIKey | RFGSHDXAWPMRNU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|