C20H22N4O3S — CID 174497157
[4-(3-cyanophenyl)-7-ethyl-2-(2-methoxyethylamino)pyrrolo[1,2-b]pyridazin-3-yl]methanesulfinic acid (PubChem CID 174497157) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is [4-(3-cyanophenyl)-7-ethyl-2-(2-methoxyethylamino)pyrrolo[1,2-b]pyridazin-3-yl]methanesulfinic acid.
| Compound Name | [4-(3-cyanophenyl)-7-ethyl-2-(2-methoxyethylamino)pyrrolo[1,2-b]pyridazin-3-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174497157 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [4-(3-cyanophenyl)-7-ethyl-2-(2-methoxyethylamino)pyrrolo[1,2-b]pyridazin-3-yl]methanesulfinic acid |
| SMILES | CCc1ccc2c(-c3cccc(C#N)c3)c(CS(=O)O)c(NCCOC)nn12 |
| InChI | InChI=1S/C20H22N4O3S/c1-3-16-7-8-18-19(15-6-4-5-14(11-15)12-21)17(13-28(25)26)20(23-24(16)18)22-9-10-27-2/h4-8,11H,3,9-10,13H2,1-2H3,(H,22,23)(H,25,26) |
| InChIKey | QNKXNIRAIRXWSM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|