About 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid
4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174498214) has the molecular formula C11H13NO5
and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid |
| PubChem CID | 174498214 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(C(=O)O)ccc(OCCN)c1C(=O)O |
| InChI | InChI=1S/C11H13NO5/c1-6-7(10(13)14)2-3-8(17-5-4-12)9(6)11(15)16/h2-3H,4-5,12H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | YHTPTDMKNKCAKU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid (CID 174498214) is 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid is Cc1c(C(=O)O)ccc(OCCN)c1C(=O)O.
What is the InChIKey of 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid?
The InChIKey is YHTPTDMKNKCAKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO5/c1-6-7(10(13)14)2-3-8(17-5-4-12)9(6)11(15)16/h2-3H,4-5,12H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid?
4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid has a molecular weight of 239.23 g/mol, XLogP of 0.73, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethoxy)-2-methylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 174498214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).