C22H20ClN3O4S3 — CID 174498850
[2-[3-(aminomethyl)anilino]-1,3-thiazol-5-yl]-(2-methylphenyl)methanone;5-chlorothiophene-2-sulfonic acid (PubChem CID 174498850) has the molecular formula C22H20ClN3O4S3 and a molecular weight of 522.07 g/mol. Its IUPAC name is [2-[3-(aminomethyl)anilino]-1,3-thiazol-5-yl]-(2-methylphenyl)methanone;5-chlorothiophene-2-sulfonic acid.
| Compound Name | [2-[3-(aminomethyl)anilino]-1,3-thiazol-5-yl]-(2-methylphenyl)methanone;5-chlorothiophene-2-sulfonic acid |
|---|---|
| PubChem CID | 174498850 |
| Molecular Formula | C22H20ClN3O4S3 |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | [2-[3-(aminomethyl)anilino]-1,3-thiazol-5-yl]-(2-methylphenyl)methanone;5-chlorothiophene-2-sulfonic acid |
| SMILES | Cc1ccccc1C(=O)c1cnc(Nc2cccc(CN)c2)s1.O=S(=O)(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H17N3OS.C4H3ClO3S2/c1-12-5-2-3-8-15(12)17(22)16-11-20-18(23-16)21-14-7-4-6-13(9-14)10-19;5-3-1-2-4(9-3)10(6,7)8/h2-9,11H,10,19H2,1H3,(H,20,21);1-2H,(H,6,7,8) |
| InChIKey | JUNPIWMCJJAUBJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|